C9H18O5S — CID 87648370
(4R,5S,6R,7R)-4,5,6,7,8-pentahydroxy-2-methyloctane-3-thione (PubChem CID 87648370) has the molecular formula C9H18O5S and a molecular weight of 238.30 g/mol. Its IUPAC name is (4R,5S,6R,7R)-4,5,6,7,8-pentahydroxy-2-methyloctane-3-thione.
| Compound Name | (4R,5S,6R,7R)-4,5,6,7,8-pentahydroxy-2-methyloctane-3-thione |
|---|---|
| PubChem CID | 87648370 |
| Molecular Formula | C9H18O5S |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | (4R,5S,6R,7R)-4,5,6,7,8-pentahydroxy-2-methyloctane-3-thione |
| SMILES | CC(C)C(=S)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H18O5S/c1-4(2)9(15)8(14)7(13)6(12)5(11)3-10/h4-8,10-14H,3H2,1-2H3/t5-,6-,7+,8-/m1/s1 |
| InChIKey | YNAGLKOBLOKHEO-OOJXKGFFSA-N |
| XLogP | -1.55 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|