About (2S)-3-methyl-2-(1,1,1-trifluorooct-7-en-2-ylamino)butan-1-ol
(2S)-3-methyl-2-(1,1,1-trifluorooct-7-en-2-ylamino)butan-1-ol (PubChem CID 87648418) has the molecular formula C13H24F3NO
and a molecular weight of 267.33 g/mol. Its IUPAC name is (2S)-3-methyl-2-(1,1,1-trifluorooct-7-en-2-ylamino)butan-1-ol.
Molecular Properties
| Compound Name | (2S)-3-methyl-2-(1,1,1-trifluorooct-7-en-2-ylamino)butan-1-ol |
| PubChem CID | 87648418 |
| Molecular Formula | C13H24F3NO |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (2S)-3-methyl-2-(1,1,1-trifluorooct-7-en-2-ylamino)butan-1-ol |
| SMILES | C=CCCCCC(N[C@H](CO)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C13H24F3NO/c1-4-5-6-7-8-12(13(14,15)16)17-11(9-18)10(2)3/h4,10-12,17-18H,1,5-9H2,2-3H3/t11-,12?/m1/s1 |
| InChIKey | RXKWVQORPTZUOI-JHJMLUEUSA-N |
| XLogP | 3.27 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-3-methyl-2-(1,1,1-trifluorooct-7-en-2-ylamino)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-methyl-2-(1,1,1-trifluorooct-7-en-2-ylamino)butan-1-ol?
The IUPAC name of (2S)-3-methyl-2-(1,1,1-trifluorooct-7-en-2-ylamino)butan-1-ol (CID 87648418) is (2S)-3-methyl-2-(1,1,1-trifluorooct-7-en-2-ylamino)butan-1-ol.
What is the SMILES notation for (2S)-3-methyl-2-(1,1,1-trifluorooct-7-en-2-ylamino)butan-1-ol?
The canonical SMILES for (2S)-3-methyl-2-(1,1,1-trifluorooct-7-en-2-ylamino)butan-1-ol is C=CCCCCC(N[C@H](CO)C(C)C)C(F)(F)F.
What is the InChIKey of (2S)-3-methyl-2-(1,1,1-trifluorooct-7-en-2-ylamino)butan-1-ol?
The InChIKey is RXKWVQORPTZUOI-JHJMLUEUSA-N. The full InChI is InChI=1S/C13H24F3NO/c1-4-5-6-7-8-12(13(14,15)16)17-11(9-18)10(2)3/h4,10-12,17-18H,1,5-9H2,2-3H3/t11-,12?/m1/s1.
What are the key properties of (2S)-3-methyl-2-(1,1,1-trifluorooct-7-en-2-ylamino)butan-1-ol?
(2S)-3-methyl-2-(1,1,1-trifluorooct-7-en-2-ylamino)butan-1-ol has a molecular weight of 267.33 g/mol, XLogP of 3.27, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-methyl-2-(1,1,1-trifluorooct-7-en-2-ylamino)butan-1-ol is sourced from PubChem (CID 87648418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).