C17H15FO4 — CID 8764873
(4-fluorophenyl) (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 8764873) has the molecular formula C17H15FO4 and a molecular weight of 302.30 g/mol. Its IUPAC name is (4-fluorophenyl) (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (4-fluorophenyl) (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8764873 |
| Molecular Formula | C17H15FO4 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (4-fluorophenyl) (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)Oc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H15FO4/c1-20-15-8-9-16(21-2)12(11-15)3-10-17(19)22-14-6-4-13(18)5-7-14/h3-11H,1-2H3/b10-3+ |
| InChIKey | HSQAKQVVETYIHC-XCVCLJGOSA-N |
| XLogP | 3.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|