About bis(2H-indeno[1,2-g]indol-2-ide);zirconium(2+)
bis(2H-indeno[1,2-g]indol-2-ide);zirconium(2+) (PubChem CID 87649127) has the molecular formula C30H16N2Zr
and a molecular weight of 495.70 g/mol. Its IUPAC name is bis(2H-indeno[1,2-g]indol-2-ide);zirconium(2+).
Molecular Properties
| Compound Name | bis(2H-indeno[1,2-g]indol-2-ide);zirconium(2+) |
| PubChem CID | 87649127 |
| Molecular Formula | C30H16N2Zr |
| Molecular Weight | 495.70 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | bis(2H-indeno[1,2-g]indol-2-ide);zirconium(2+) |
| SMILES | [C-]1=Nc2c3c(ccc2=C1)=c1ccccc1=C3.[C-]1=Nc2c3c(ccc2=C1)=c1ccccc1=C3.[Zr+2] |
| InChI | InChI=1S/2C15H8N.Zr/c2*1-2-4-12-11(3-1)9-14-13(12)6-5-10-7-8-16-15(10)14;/h2*1-7,9H;/q2*-1;+2 |
| InChIKey | DPJXSJYFRGLARG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.70 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(2H-indeno[1,2-g]indol-2-ide);zirconium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2H-indeno[1,2-g]indol-2-ide);zirconium(2+)?
The IUPAC name of bis(2H-indeno[1,2-g]indol-2-ide);zirconium(2+) (CID 87649127) is bis(2H-indeno[1,2-g]indol-2-ide);zirconium(2+).
What is the SMILES notation for bis(2H-indeno[1,2-g]indol-2-ide);zirconium(2+)?
The canonical SMILES for bis(2H-indeno[1,2-g]indol-2-ide);zirconium(2+) is [C-]1=Nc2c3c(ccc2=C1)=c1ccccc1=C3.[C-]1=Nc2c3c(ccc2=C1)=c1ccccc1=C3.[Zr+2].
What is the InChIKey of bis(2H-indeno[1,2-g]indol-2-ide);zirconium(2+)?
The InChIKey is DPJXSJYFRGLARG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H8N.Zr/c2*1-2-4-12-11(3-1)9-14-13(12)6-5-10-7-8-16-15(10)14;/h2*1-7,9H;/q2*-1;+2.
What are the key properties of bis(2H-indeno[1,2-g]indol-2-ide);zirconium(2+)?
bis(2H-indeno[1,2-g]indol-2-ide);zirconium(2+) has a molecular weight of 495.70 g/mol, XLogP of 2.98, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2H-indeno[1,2-g]indol-2-ide);zirconium(2+) is sourced from PubChem (CID 87649127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).