About (2-amino-2,3-dimethylheptan-4-ylidene)-bis(trifluoromethylsulfonyl)azanium
(2-amino-2,3-dimethylheptan-4-ylidene)-bis(trifluoromethylsulfonyl)azanium (PubChem CID 87649329) has the molecular formula C11H19F6N2O4S2+
and a molecular weight of 421.41 g/mol. Its IUPAC name is (2-amino-2,3-dimethylheptan-4-ylidene)-bis(trifluoromethylsulfonyl)azanium.
Molecular Properties
| Compound Name | (2-amino-2,3-dimethylheptan-4-ylidene)-bis(trifluoromethylsulfonyl)azanium |
| PubChem CID | 87649329 |
| Molecular Formula | C11H19F6N2O4S2+ |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | (2-amino-2,3-dimethylheptan-4-ylidene)-bis(trifluoromethylsulfonyl)azanium |
| SMILES | CCCC(C(C)C(C)(C)N)=[N+](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H19F6N2O4S2/c1-5-6-8(7(2)9(3,4)18)19(24(20,21)10(12,13)14)25(22,23)11(15,16)17/h7H,5-6,18H2,1-4H3/q+1 |
| InChIKey | ZZHHAUXSSWWJJN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-2,3-dimethylheptan-4-ylidene)-bis(trifluoromethylsulfonyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-2,3-dimethylheptan-4-ylidene)-bis(trifluoromethylsulfonyl)azanium?
The IUPAC name of (2-amino-2,3-dimethylheptan-4-ylidene)-bis(trifluoromethylsulfonyl)azanium (CID 87649329) is (2-amino-2,3-dimethylheptan-4-ylidene)-bis(trifluoromethylsulfonyl)azanium.
What is the SMILES notation for (2-amino-2,3-dimethylheptan-4-ylidene)-bis(trifluoromethylsulfonyl)azanium?
The canonical SMILES for (2-amino-2,3-dimethylheptan-4-ylidene)-bis(trifluoromethylsulfonyl)azanium is CCCC(C(C)C(C)(C)N)=[N+](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F.
What is the InChIKey of (2-amino-2,3-dimethylheptan-4-ylidene)-bis(trifluoromethylsulfonyl)azanium?
The InChIKey is ZZHHAUXSSWWJJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F6N2O4S2/c1-5-6-8(7(2)9(3,4)18)19(24(20,21)10(12,13)14)25(22,23)11(15,16)17/h7H,5-6,18H2,1-4H3/q+1.
What are the key properties of (2-amino-2,3-dimethylheptan-4-ylidene)-bis(trifluoromethylsulfonyl)azanium?
(2-amino-2,3-dimethylheptan-4-ylidene)-bis(trifluoromethylsulfonyl)azanium has a molecular weight of 421.41 g/mol, XLogP of 2.31, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2,3-dimethylheptan-4-ylidene)-bis(trifluoromethylsulfonyl)azanium is sourced from PubChem (CID 87649329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).