C14H19N5O4 — CID 87649486
(1S)-5-[5-(hydroxycarbamoyl)pyrimidin-2-yl]-4-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 87649486) has the molecular formula C14H19N5O4 and a molecular weight of 321.34 g/mol. Its IUPAC name is (1S)-5-[5-(hydroxycarbamoyl)pyrimidin-2-yl]-4-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S)-5-[5-(hydroxycarbamoyl)pyrimidin-2-yl]-4-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 87649486 |
| Molecular Formula | C14H19N5O4 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (1S)-5-[5-(hydroxycarbamoyl)pyrimidin-2-yl]-4-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CC(C)C12C[C@@H](CN1c1ncc(C(=O)NO)cn1)N(C(=O)O)C2 |
| InChI | InChI=1S/C14H19N5O4/c1-8(2)14-3-10(18(7-14)13(21)22)6-19(14)12-15-4-9(5-16-12)11(20)17-23/h4-5,8,10,23H,3,6-7H2,1-2H3,(H,17,20)(H,21,22)/t10-,14?/m0/s1 |
| InChIKey | GUDUPWZTPOQUAX-XLLULAGJSA-N |
| XLogP | 0.56 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|