About 2-[N-[2,2-bis(pyridin-2-ylmethylamino)ethyl]-3-(trifluoromethyl)anilino]benzoic acid
2-[N-[2,2-bis(pyridin-2-ylmethylamino)ethyl]-3-(trifluoromethyl)anilino]benzoic acid (PubChem CID 87649507) has the molecular formula C28H26F3N5O2
and a molecular weight of 521.54 g/mol. Its IUPAC name is 2-[N-[2,2-bis(pyridin-2-ylmethylamino)ethyl]-3-(trifluoromethyl)anilino]benzoic acid.
Molecular Properties
| Compound Name | 2-[N-[2,2-bis(pyridin-2-ylmethylamino)ethyl]-3-(trifluoromethyl)anilino]benzoic acid |
| PubChem CID | 87649507 |
| Molecular Formula | C28H26F3N5O2 |
| Molecular Weight | 521.54 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 2-[N-[2,2-bis(pyridin-2-ylmethylamino)ethyl]-3-(trifluoromethyl)anilino]benzoic acid |
| SMILES | O=C(O)c1ccccc1N(CC(NCc1ccccn1)NCc1ccccn1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H26F3N5O2/c29-28(30,31)20-8-7-11-23(16-20)36(25-13-2-1-12-24(25)27(37)38)19-26(34-17-21-9-3-5-14-32-21)35-18-22-10-4-6-15-33-22/h1-16,26,34-35H,17-19H2,(H,37,38) |
| InChIKey | ICHUKGZUTGTUKX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[N-[2,2-bis(pyridin-2-ylmethylamino)ethyl]-3-(trifluoromethyl)anilino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[N-[2,2-bis(pyridin-2-ylmethylamino)ethyl]-3-(trifluoromethyl)anilino]benzoic acid?
The IUPAC name of 2-[N-[2,2-bis(pyridin-2-ylmethylamino)ethyl]-3-(trifluoromethyl)anilino]benzoic acid (CID 87649507) is 2-[N-[2,2-bis(pyridin-2-ylmethylamino)ethyl]-3-(trifluoromethyl)anilino]benzoic acid.
What is the SMILES notation for 2-[N-[2,2-bis(pyridin-2-ylmethylamino)ethyl]-3-(trifluoromethyl)anilino]benzoic acid?
The canonical SMILES for 2-[N-[2,2-bis(pyridin-2-ylmethylamino)ethyl]-3-(trifluoromethyl)anilino]benzoic acid is O=C(O)c1ccccc1N(CC(NCc1ccccn1)NCc1ccccn1)c1cccc(C(F)(F)F)c1.
What is the InChIKey of 2-[N-[2,2-bis(pyridin-2-ylmethylamino)ethyl]-3-(trifluoromethyl)anilino]benzoic acid?
The InChIKey is ICHUKGZUTGTUKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26F3N5O2/c29-28(30,31)20-8-7-11-23(16-20)36(25-13-2-1-12-24(25)27(37)38)19-26(34-17-21-9-3-5-14-32-21)35-18-22-10-4-6-15-33-22/h1-16,26,34-35H,17-19H2,(H,37,38).
What are the key properties of 2-[N-[2,2-bis(pyridin-2-ylmethylamino)ethyl]-3-(trifluoromethyl)anilino]benzoic acid?
2-[N-[2,2-bis(pyridin-2-ylmethylamino)ethyl]-3-(trifluoromethyl)anilino]benzoic acid has a molecular weight of 521.54 g/mol, XLogP of 5.24, 11 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[N-[2,2-bis(pyridin-2-ylmethylamino)ethyl]-3-(trifluoromethyl)anilino]benzoic acid is sourced from PubChem (CID 87649507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).