About 5-iodo-1,6-dihydropyrrolo[2,3-b]pyrazine
5-iodo-1,6-dihydropyrrolo[2,3-b]pyrazine (PubChem CID 87649753) has the molecular formula C6H6IN3
and a molecular weight of 247.04 g/mol. Its IUPAC name is 5-iodo-1,6-dihydropyrrolo[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 5-iodo-1,6-dihydropyrrolo[2,3-b]pyrazine |
| PubChem CID | 87649753 |
| Molecular Formula | C6H6IN3 |
| Molecular Weight | 247.04 g/mol |
| Exact Mass | 246.96 |
| IUPAC Name | 5-iodo-1,6-dihydropyrrolo[2,3-b]pyrazine |
| SMILES | IN1CC=C2NC=CN=C21 |
| InChI | InChI=1S/C6H6IN3/c7-10-4-1-5-6(10)9-3-2-8-5/h1-3,8H,4H2 |
| InChIKey | IEAXIWQZIKDRGF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.04 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-1,6-dihydropyrrolo[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-1,6-dihydropyrrolo[2,3-b]pyrazine?
The IUPAC name of 5-iodo-1,6-dihydropyrrolo[2,3-b]pyrazine (CID 87649753) is 5-iodo-1,6-dihydropyrrolo[2,3-b]pyrazine.
What is the SMILES notation for 5-iodo-1,6-dihydropyrrolo[2,3-b]pyrazine?
The canonical SMILES for 5-iodo-1,6-dihydropyrrolo[2,3-b]pyrazine is IN1CC=C2NC=CN=C21.
What is the InChIKey of 5-iodo-1,6-dihydropyrrolo[2,3-b]pyrazine?
The InChIKey is IEAXIWQZIKDRGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6IN3/c7-10-4-1-5-6(10)9-3-2-8-5/h1-3,8H,4H2.
What are the key properties of 5-iodo-1,6-dihydropyrrolo[2,3-b]pyrazine?
5-iodo-1,6-dihydropyrrolo[2,3-b]pyrazine has a molecular weight of 247.04 g/mol, XLogP of 1.01, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-1,6-dihydropyrrolo[2,3-b]pyrazine is sourced from PubChem (CID 87649753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).