C19H23ClN7+ — CID 87649837
5-[6-chloro-3-(3-methyl-2H-indazol-5-yl)-1,2,4-triazin-5-yl]-2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazin-5-ium (PubChem CID 87649837) has the molecular formula C19H23ClN7+ and a molecular weight of 384.90 g/mol. Its IUPAC name is 5-[6-chloro-3-(3-methyl-2H-indazol-5-yl)-1,2,4-triazin-5-yl]-2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazin-5-ium.
| Compound Name | 5-[6-chloro-3-(3-methyl-2H-indazol-5-yl)-1,2,4-triazin-5-yl]-2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazin-5-ium |
|---|---|
| PubChem CID | 87649837 |
| Molecular Formula | C19H23ClN7+ |
| Molecular Weight | 384.90 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 5-[6-chloro-3-(3-methyl-2H-indazol-5-yl)-1,2,4-triazin-5-yl]-2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazin-5-ium |
| SMILES | Cc1[nH]nc2ccc(-c3nnc(Cl)c([N+]45CCCCC4CNCC5)n3)cc12 |
| InChI | InChI=1S/C19H23ClN7/c1-12-15-10-13(5-6-16(15)24-23-12)18-22-19(17(20)25-26-18)27-8-3-2-4-14(27)11-21-7-9-27/h5-6,10,14,21H,2-4,7-9,11H2,1H3,(H,23,24)/q+1 |
| InChIKey | GCBJYQSLKXJDBO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.90 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|