About [(3S)-1-benzyl-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-3-yl]methanamine
[(3S)-1-benzyl-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-3-yl]methanamine (PubChem CID 87650101) has the molecular formula C19H23Cl2N2+
and a molecular weight of 350.31 g/mol. Its IUPAC name is [(3S)-1-benzyl-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-3-yl]methanamine.
Molecular Properties
| Compound Name | [(3S)-1-benzyl-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-3-yl]methanamine |
| PubChem CID | 87650101 |
| Molecular Formula | C19H23Cl2N2+ |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | [(3S)-1-benzyl-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-3-yl]methanamine |
| SMILES | NC[C@@H]1CC[N+](Cc2ccccc2)(Cc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C19H23Cl2N2/c20-18-7-6-17(19(21)10-18)14-23(9-8-16(11-22)13-23)12-15-4-2-1-3-5-15/h1-7,10,16H,8-9,11-14,22H2/q+1/t16-,23?/m0/s1 |
| InChIKey | HRKDBIOICVPCMQ-GZWBLTSWSA-N |
| XLogP | 4.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-1-benzyl-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-1-benzyl-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-3-yl]methanamine?
The IUPAC name of [(3S)-1-benzyl-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-3-yl]methanamine (CID 87650101) is [(3S)-1-benzyl-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-3-yl]methanamine.
What is the SMILES notation for [(3S)-1-benzyl-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-3-yl]methanamine?
The canonical SMILES for [(3S)-1-benzyl-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-3-yl]methanamine is NC[C@@H]1CC[N+](Cc2ccccc2)(Cc2ccc(Cl)cc2Cl)C1.
What is the InChIKey of [(3S)-1-benzyl-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-3-yl]methanamine?
The InChIKey is HRKDBIOICVPCMQ-GZWBLTSWSA-N. The full InChI is InChI=1S/C19H23Cl2N2/c20-18-7-6-17(19(21)10-18)14-23(9-8-16(11-22)13-23)12-15-4-2-1-3-5-15/h1-7,10,16H,8-9,11-14,22H2/q+1/t16-,23?/m0/s1.
What are the key properties of [(3S)-1-benzyl-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-3-yl]methanamine?
[(3S)-1-benzyl-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-3-yl]methanamine has a molecular weight of 350.31 g/mol, XLogP of 4.49, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-1-benzyl-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-3-yl]methanamine is sourced from PubChem (CID 87650101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).