About tributylazanium;trifluoromethanesulfonate
tributylazanium;trifluoromethanesulfonate (PubChem CID 87650505) has the molecular formula C13H28F3NO3S
and a molecular weight of 335.43 g/mol. Its IUPAC name is tributylazanium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | tributylazanium;trifluoromethanesulfonate |
| PubChem CID | 87650505 |
| Molecular Formula | C13H28F3NO3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | tributylazanium;trifluoromethanesulfonate |
| SMILES | CCCC[NH+](CCCC)CCCC.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C12H27N.CHF3O3S/c1-4-7-10-13(11-8-5-2)12-9-6-3;2-1(3,4)8(5,6)7/h4-12H2,1-3H3;(H,5,6,7) |
| InChIKey | FZEHCVMJFTXUCY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze tributylazanium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributylazanium;trifluoromethanesulfonate?
The IUPAC name of tributylazanium;trifluoromethanesulfonate (CID 87650505) is tributylazanium;trifluoromethanesulfonate.
What is the SMILES notation for tributylazanium;trifluoromethanesulfonate?
The canonical SMILES for tributylazanium;trifluoromethanesulfonate is CCCC[NH+](CCCC)CCCC.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of tributylazanium;trifluoromethanesulfonate?
The InChIKey is FZEHCVMJFTXUCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N.CHF3O3S/c1-4-7-10-13(11-8-5-2)12-9-6-3;2-1(3,4)8(5,6)7/h4-12H2,1-3H3;(H,5,6,7).
What are the key properties of tributylazanium;trifluoromethanesulfonate?
tributylazanium;trifluoromethanesulfonate has a molecular weight of 335.43 g/mol, XLogP of 2.32, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tributylazanium;trifluoromethanesulfonate is sourced from PubChem (CID 87650505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).