C26H15F13N4O5 — CID 87650616
3-[2-fluoro-4-(trifluoromethyl)phenyl]-N-(2,2,2-trifluoro-1-pyridin-1-ium-2-ylethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide;bis(2,2,2-trifluoroacetate) (PubChem CID 87650616) has the molecular formula C26H15F13N4O5 and a molecular weight of 710.40 g/mol. Its IUPAC name is 3-[2-fluoro-4-(trifluoromethyl)phenyl]-N-(2,2,2-trifluoro-1-pyridin-1-ium-2-ylethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide;bis(2,2,2-trifluoroacetate).
| Compound Name | 3-[2-fluoro-4-(trifluoromethyl)phenyl]-N-(2,2,2-trifluoro-1-pyridin-1-ium-2-ylethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 87650616 |
| Molecular Formula | C26H15F13N4O5 |
| Molecular Weight | 710.40 g/mol |
| Exact Mass | 710.08 |
| IUPAC Name | 3-[2-fluoro-4-(trifluoromethyl)phenyl]-N-(2,2,2-trifluoro-1-pyridin-1-ium-2-ylethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide;bis(2,2,2-trifluoroacetate) |
| SMILES | O=C(NC(c1cccc[nH+]1)C(F)(F)F)c1[nH]c(-c2ccc(C(F)(F)F)cc2F)[n+]2ccccc12.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C22H13F7N4O.2C2HF3O2/c23-14-11-12(21(24,25)26)7-8-13(14)19-31-17(16-6-2-4-10-33(16)19)20(34)32-18(22(27,28)29)15-5-1-3-9-30-15;2*3-2(4,5)1(6)7/h1-11,18H,(H,32,34);2*(H,6,7) |
| InChIKey | ATTFZQOVLNEJHC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 143.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|