About [(3S)-1-[(2,3-dichlorophenyl)methyl]-1-(2-methylpropyl)pyrrolidin-1-ium-3-yl]methanamine
[(3S)-1-[(2,3-dichlorophenyl)methyl]-1-(2-methylpropyl)pyrrolidin-1-ium-3-yl]methanamine (PubChem CID 87650658) has the molecular formula C16H25Cl2N2+
and a molecular weight of 316.30 g/mol. Its IUPAC name is [(3S)-1-[(2,3-dichlorophenyl)methyl]-1-(2-methylpropyl)pyrrolidin-1-ium-3-yl]methanamine.
Molecular Properties
| Compound Name | [(3S)-1-[(2,3-dichlorophenyl)methyl]-1-(2-methylpropyl)pyrrolidin-1-ium-3-yl]methanamine |
| PubChem CID | 87650658 |
| Molecular Formula | C16H25Cl2N2+ |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | [(3S)-1-[(2,3-dichlorophenyl)methyl]-1-(2-methylpropyl)pyrrolidin-1-ium-3-yl]methanamine |
| SMILES | CC(C)C[N+]1(Cc2cccc(Cl)c2Cl)CC[C@@H](CN)C1 |
| InChI | InChI=1S/C16H25Cl2N2/c1-12(2)9-20(7-6-13(8-19)10-20)11-14-4-3-5-15(17)16(14)18/h3-5,12-13H,6-11,19H2,1-2H3/q+1/t13-,20?/m0/s1 |
| InChIKey | QHFJYXJPOWGZFM-SZQRVLIRSA-N |
| XLogP | 3.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-1-[(2,3-dichlorophenyl)methyl]-1-(2-methylpropyl)pyrrolidin-1-ium-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-1-[(2,3-dichlorophenyl)methyl]-1-(2-methylpropyl)pyrrolidin-1-ium-3-yl]methanamine?
The IUPAC name of [(3S)-1-[(2,3-dichlorophenyl)methyl]-1-(2-methylpropyl)pyrrolidin-1-ium-3-yl]methanamine (CID 87650658) is [(3S)-1-[(2,3-dichlorophenyl)methyl]-1-(2-methylpropyl)pyrrolidin-1-ium-3-yl]methanamine.
What is the SMILES notation for [(3S)-1-[(2,3-dichlorophenyl)methyl]-1-(2-methylpropyl)pyrrolidin-1-ium-3-yl]methanamine?
The canonical SMILES for [(3S)-1-[(2,3-dichlorophenyl)methyl]-1-(2-methylpropyl)pyrrolidin-1-ium-3-yl]methanamine is CC(C)C[N+]1(Cc2cccc(Cl)c2Cl)CC[C@@H](CN)C1.
What is the InChIKey of [(3S)-1-[(2,3-dichlorophenyl)methyl]-1-(2-methylpropyl)pyrrolidin-1-ium-3-yl]methanamine?
The InChIKey is QHFJYXJPOWGZFM-SZQRVLIRSA-N. The full InChI is InChI=1S/C16H25Cl2N2/c1-12(2)9-20(7-6-13(8-19)10-20)11-14-4-3-5-15(17)16(14)18/h3-5,12-13H,6-11,19H2,1-2H3/q+1/t13-,20?/m0/s1.
What are the key properties of [(3S)-1-[(2,3-dichlorophenyl)methyl]-1-(2-methylpropyl)pyrrolidin-1-ium-3-yl]methanamine?
[(3S)-1-[(2,3-dichlorophenyl)methyl]-1-(2-methylpropyl)pyrrolidin-1-ium-3-yl]methanamine has a molecular weight of 316.30 g/mol, XLogP of 3.94, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-1-[(2,3-dichlorophenyl)methyl]-1-(2-methylpropyl)pyrrolidin-1-ium-3-yl]methanamine is sourced from PubChem (CID 87650658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).