[(2R,3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-yl]carbamic acid

C6H13NO4S — CID 87652058

IUPAC[(2R,3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-yl]carbamic acid
SMILESCSC[C@@H](O)[C@@H](CO)NC(=O)O
InChIInChI=1S/C6H13NO4S/c1-12-3-5(9)4(2-8)7-6(10)11/h4-5,7-9H,2-3H2,1H3,(H,10,11)/t4-,5-/m1/s1
InChIKeyYZAUNWBKSASSCF-RFZPGFLSSA-N
MW195.24 g/mol
LogP-0.66
Rot. Bonds5

About [(2R,3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-yl]carbamic acid

[(2R,3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-yl]carbamic acid (PubChem CID 87652058) has the molecular formula C6H13NO4S and a molecular weight of 195.24 g/mol. Its IUPAC name is [(2R,3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-yl]carbamic acid.

Molecular Properties

Compound Name[(2R,3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-yl]carbamic acid
PubChem CID87652058
Molecular FormulaC6H13NO4S
Molecular Weight195.24 g/mol
Exact Mass195.06
IUPAC Name[(2R,3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-yl]carbamic acid
SMILESCSC[C@@H](O)[C@@H](CO)NC(=O)O
InChIInChI=1S/C6H13NO4S/c1-12-3-5(9)4(2-8)7-6(10)11/h4-5,7-9H,2-3H2,1H3,(H,10,11)/t4-,5-/m1/s1
InChIKeyYZAUNWBKSASSCF-RFZPGFLSSA-N
XLogP-0.66
TPSA89.79 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.24
LogP ≤ 5-0.66
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze [(2R,3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-yl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(2R,3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-yl]carbamic acid?
The IUPAC name of [(2R,3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-yl]carbamic acid (CID 87652058) is [(2R,3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-yl]carbamic acid.
What is the SMILES notation for [(2R,3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-yl]carbamic acid?
The canonical SMILES for [(2R,3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-yl]carbamic acid is CSC[C@@H](O)[C@@H](CO)NC(=O)O.
What is the InChIKey of [(2R,3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-yl]carbamic acid?
The InChIKey is YZAUNWBKSASSCF-RFZPGFLSSA-N. The full InChI is InChI=1S/C6H13NO4S/c1-12-3-5(9)4(2-8)7-6(10)11/h4-5,7-9H,2-3H2,1H3,(H,10,11)/t4-,5-/m1/s1.
What are the key properties of [(2R,3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-yl]carbamic acid?
[(2R,3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-yl]carbamic acid has a molecular weight of 195.24 g/mol, XLogP of -0.66, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-yl]carbamic acid is sourced from PubChem (CID 87652058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).