About 2-bromo-5-methoxy-4,6-dimethylpyridine-3-carboxamide
2-bromo-5-methoxy-4,6-dimethylpyridine-3-carboxamide (PubChem CID 87652137) has the molecular formula C9H11BrN2O2
and a molecular weight of 259.10 g/mol. Its IUPAC name is 2-bromo-5-methoxy-4,6-dimethylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-bromo-5-methoxy-4,6-dimethylpyridine-3-carboxamide |
| PubChem CID | 87652137 |
| Molecular Formula | C9H11BrN2O2 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 2-bromo-5-methoxy-4,6-dimethylpyridine-3-carboxamide |
| SMILES | COc1c(C)nc(Br)c(C(N)=O)c1C |
| InChI | InChI=1S/C9H11BrN2O2/c1-4-6(9(11)13)8(10)12-5(2)7(4)14-3/h1-3H3,(H2,11,13) |
| InChIKey | PATKKAMVWYXHEP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-methoxy-4,6-dimethylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-methoxy-4,6-dimethylpyridine-3-carboxamide?
The IUPAC name of 2-bromo-5-methoxy-4,6-dimethylpyridine-3-carboxamide (CID 87652137) is 2-bromo-5-methoxy-4,6-dimethylpyridine-3-carboxamide.
What is the SMILES notation for 2-bromo-5-methoxy-4,6-dimethylpyridine-3-carboxamide?
The canonical SMILES for 2-bromo-5-methoxy-4,6-dimethylpyridine-3-carboxamide is COc1c(C)nc(Br)c(C(N)=O)c1C.
What is the InChIKey of 2-bromo-5-methoxy-4,6-dimethylpyridine-3-carboxamide?
The InChIKey is PATKKAMVWYXHEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrN2O2/c1-4-6(9(11)13)8(10)12-5(2)7(4)14-3/h1-3H3,(H2,11,13).
What are the key properties of 2-bromo-5-methoxy-4,6-dimethylpyridine-3-carboxamide?
2-bromo-5-methoxy-4,6-dimethylpyridine-3-carboxamide has a molecular weight of 259.10 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-methoxy-4,6-dimethylpyridine-3-carboxamide is sourced from PubChem (CID 87652137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).