C19H20Br4O4 — CID 87652159
1,2,4,5-tetrabromo-3-ethylperoxy-6-[2-(4-ethylperoxyphenyl)propan-2-yl]benzene (PubChem CID 87652159) has the molecular formula C19H20Br4O4 and a molecular weight of 631.98 g/mol. Its IUPAC name is 1,2,4,5-tetrabromo-3-ethylperoxy-6-[2-(4-ethylperoxyphenyl)propan-2-yl]benzene.
| Compound Name | 1,2,4,5-tetrabromo-3-ethylperoxy-6-[2-(4-ethylperoxyphenyl)propan-2-yl]benzene |
|---|---|
| PubChem CID | 87652159 |
| Molecular Formula | C19H20Br4O4 |
| Molecular Weight | 631.98 g/mol |
| Exact Mass | 627.81 |
| IUPAC Name | 1,2,4,5-tetrabromo-3-ethylperoxy-6-[2-(4-ethylperoxyphenyl)propan-2-yl]benzene |
| SMILES | CCOOc1ccc(C(C)(C)c2c(Br)c(Br)c(OOCC)c(Br)c2Br)cc1 |
| InChI | InChI=1S/C19H20Br4O4/c1-5-24-26-12-9-7-11(8-10-12)19(3,4)13-14(20)16(22)18(27-25-6-2)17(23)15(13)21/h7-10H,5-6H2,1-4H3 |
| InChIKey | FYTFPQASYJIFHT-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.98 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|