C13H27NO3 — CID 87652560
tert-butyl 2-[ethyl-(1-hydroxy-3-methylbutan-2-yl)amino]acetate (PubChem CID 87652560) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is tert-butyl 2-[ethyl-(1-hydroxy-3-methylbutan-2-yl)amino]acetate.
| Compound Name | tert-butyl 2-[ethyl-(1-hydroxy-3-methylbutan-2-yl)amino]acetate |
|---|---|
| PubChem CID | 87652560 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | tert-butyl 2-[ethyl-(1-hydroxy-3-methylbutan-2-yl)amino]acetate |
| SMILES | CCN(CC(=O)OC(C)(C)C)C(CO)C(C)C |
| InChI | InChI=1S/C13H27NO3/c1-7-14(11(9-15)10(2)3)8-12(16)17-13(4,5)6/h10-11,15H,7-9H2,1-6H3 |
| InChIKey | LZRSVSZXEFDQJW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |