C22H14F7N5O5 — CID 87652675
3-(2-fluorophenyl)-N-pyrimidin-1-ium-4-yl-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide;bis(2,2,2-trifluoroacetate) (PubChem CID 87652675) has the molecular formula C22H14F7N5O5 and a molecular weight of 561.37 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-N-pyrimidin-1-ium-4-yl-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide;bis(2,2,2-trifluoroacetate).
| Compound Name | 3-(2-fluorophenyl)-N-pyrimidin-1-ium-4-yl-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 87652675 |
| Molecular Formula | C22H14F7N5O5 |
| Molecular Weight | 561.37 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | 3-(2-fluorophenyl)-N-pyrimidin-1-ium-4-yl-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide;bis(2,2,2-trifluoroacetate) |
| SMILES | O=C(Nc1cc[nH+]cn1)c1[nH]c(-c2ccccc2F)[n+]2ccccc12.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C18H12FN5O.2C2HF3O2/c19-13-6-2-1-5-12(13)17-23-16(14-7-3-4-10-24(14)17)18(25)22-15-8-9-20-11-21-15;2*3-2(4,5)1(6)7/h1-11H,(H,20,21,22,25);2*(H,6,7) |
| InChIKey | DAMOBBAKAYNJRM-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 156.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.37 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|