C24H40N8O14 — CID 87652719
bis[[N'-methyl-N-[2-oxo-2-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]ethyl]carbamimidoyl]amino] (E)-but-2-enedioate (PubChem CID 87652719) has the molecular formula C24H40N8O14 and a molecular weight of 664.63 g/mol. Its IUPAC name is bis[[N'-methyl-N-[2-oxo-2-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]ethyl]carbamimidoyl]amino] (E)-but-2-enedioate.
| Compound Name | bis[[N'-methyl-N-[2-oxo-2-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]ethyl]carbamimidoyl]amino] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 87652719 |
| Molecular Formula | C24H40N8O14 |
| Molecular Weight | 664.63 g/mol |
| Exact Mass | 664.27 |
| IUPAC Name | bis[[N'-methyl-N-[2-oxo-2-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]ethyl]carbamimidoyl]amino] (E)-but-2-enedioate |
| SMILES | C/N=C(/NCC(=O)N1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO)NOC(=O)/C=C/C(=O)ON/C(=N/C)NCC(=O)N1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C24H40N8O14/c1-25-23(27-5-15(37)31-7-13(35)21(43)19(41)11(31)9-33)29-45-17(39)3-4-18(40)46-30-24(26-2)28-6-16(38)32-8-14(36)22(44)20(42)12(32)10-34/h3-4,11-14,19-22,33-36,41-44H,5-10H2,1-2H3,(H2,25,27,29)(H2,26,28,30)/b4-3+/t11-,12-,13+,14+,19-,20-,21-,22-/m1/s1 |
| InChIKey | PRCUBEKIBKFJCI-ZCNKZNBDSA-N |
| XLogP | -8.64 |
| TPSA | 327.90 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.63 |
| LogP ≤ 5 | -8.64 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|