About [3-[2-[5-[(2,5-dichloropyrimidin-4-yl)amino]-2-morpholin-4-ylphenyl]ethyl]phenyl]carbamic acid
[3-[2-[5-[(2,5-dichloropyrimidin-4-yl)amino]-2-morpholin-4-ylphenyl]ethyl]phenyl]carbamic acid (PubChem CID 87652862) has the molecular formula C23H23Cl2N5O3
and a molecular weight of 488.38 g/mol. Its IUPAC name is [3-[2-[5-[(2,5-dichloropyrimidin-4-yl)amino]-2-morpholin-4-ylphenyl]ethyl]phenyl]carbamic acid.
Molecular Properties
| Compound Name | [3-[2-[5-[(2,5-dichloropyrimidin-4-yl)amino]-2-morpholin-4-ylphenyl]ethyl]phenyl]carbamic acid |
| PubChem CID | 87652862 |
| Molecular Formula | C23H23Cl2N5O3 |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | [3-[2-[5-[(2,5-dichloropyrimidin-4-yl)amino]-2-morpholin-4-ylphenyl]ethyl]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1cccc(CCc2cc(Nc3nc(Cl)ncc3Cl)ccc2N2CCOCC2)c1 |
| InChI | InChI=1S/C23H23Cl2N5O3/c24-19-14-26-22(25)29-21(19)27-18-6-7-20(30-8-10-33-11-9-30)16(13-18)5-4-15-2-1-3-17(12-15)28-23(31)32/h1-3,6-7,12-14,28H,4-5,8-11H2,(H,31,32)(H,26,27,29) |
| InChIKey | GSMMGVOYAUXGTQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze [3-[2-[5-[(2,5-dichloropyrimidin-4-yl)amino]-2-morpholin-4-ylphenyl]ethyl]phenyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-[5-[(2,5-dichloropyrimidin-4-yl)amino]-2-morpholin-4-ylphenyl]ethyl]phenyl]carbamic acid?
The IUPAC name of [3-[2-[5-[(2,5-dichloropyrimidin-4-yl)amino]-2-morpholin-4-ylphenyl]ethyl]phenyl]carbamic acid (CID 87652862) is [3-[2-[5-[(2,5-dichloropyrimidin-4-yl)amino]-2-morpholin-4-ylphenyl]ethyl]phenyl]carbamic acid.
What is the SMILES notation for [3-[2-[5-[(2,5-dichloropyrimidin-4-yl)amino]-2-morpholin-4-ylphenyl]ethyl]phenyl]carbamic acid?
The canonical SMILES for [3-[2-[5-[(2,5-dichloropyrimidin-4-yl)amino]-2-morpholin-4-ylphenyl]ethyl]phenyl]carbamic acid is O=C(O)Nc1cccc(CCc2cc(Nc3nc(Cl)ncc3Cl)ccc2N2CCOCC2)c1.
What is the InChIKey of [3-[2-[5-[(2,5-dichloropyrimidin-4-yl)amino]-2-morpholin-4-ylphenyl]ethyl]phenyl]carbamic acid?
The InChIKey is GSMMGVOYAUXGTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23Cl2N5O3/c24-19-14-26-22(25)29-21(19)27-18-6-7-20(30-8-10-33-11-9-30)16(13-18)5-4-15-2-1-3-17(12-15)28-23(31)32/h1-3,6-7,12-14,28H,4-5,8-11H2,(H,31,32)(H,26,27,29).
What are the key properties of [3-[2-[5-[(2,5-dichloropyrimidin-4-yl)amino]-2-morpholin-4-ylphenyl]ethyl]phenyl]carbamic acid?
[3-[2-[5-[(2,5-dichloropyrimidin-4-yl)amino]-2-morpholin-4-ylphenyl]ethyl]phenyl]carbamic acid has a molecular weight of 488.38 g/mol, XLogP of 5.24, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-[5-[(2,5-dichloropyrimidin-4-yl)amino]-2-morpholin-4-ylphenyl]ethyl]phenyl]carbamic acid is sourced from PubChem (CID 87652862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).