C27H36N6O3 — CID 87653063
1-ethyl-N-[(4-methoxyphenyl)methyl]-4-[[4-[(2-methylpropan-2-yl)oxyimino]cyclohexyl]amino]pyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 87653063) has the molecular formula C27H36N6O3 and a molecular weight of 492.62 g/mol. Its IUPAC name is 1-ethyl-N-[(4-methoxyphenyl)methyl]-4-[[4-[(2-methylpropan-2-yl)oxyimino]cyclohexyl]amino]pyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | 1-ethyl-N-[(4-methoxyphenyl)methyl]-4-[[4-[(2-methylpropan-2-yl)oxyimino]cyclohexyl]amino]pyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 87653063 |
| Molecular Formula | C27H36N6O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | 1-ethyl-N-[(4-methoxyphenyl)methyl]-4-[[4-[(2-methylpropan-2-yl)oxyimino]cyclohexyl]amino]pyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | CCn1ncc2c(NC3CCC(=NOC(C)(C)C)CC3)c(C(=O)NCc3ccc(OC)cc3)cnc21 |
| InChI | InChI=1S/C27H36N6O3/c1-6-33-25-22(17-30-33)24(31-19-9-11-20(12-10-19)32-36-27(2,3)4)23(16-28-25)26(34)29-15-18-7-13-21(35-5)14-8-18/h7-8,13-14,16-17,19H,6,9-12,15H2,1-5H3,(H,28,31)(H,29,34)/b32-20- |
| InChIKey | GDDRIDGMMJUMFF-RGXNXFOYSA-N |
| XLogP | 4.92 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|