About 4-chloro-1-ethylpyrazolo[3,4-b]pyridine;N-propylformamide
4-chloro-1-ethylpyrazolo[3,4-b]pyridine;N-propylformamide (PubChem CID 87653399) has the molecular formula C12H17ClN4O
and a molecular weight of 268.75 g/mol. Its IUPAC name is 4-chloro-1-ethylpyrazolo[3,4-b]pyridine;N-propylformamide.
Molecular Properties
| Compound Name | 4-chloro-1-ethylpyrazolo[3,4-b]pyridine;N-propylformamide |
| PubChem CID | 87653399 |
| Molecular Formula | C12H17ClN4O |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 4-chloro-1-ethylpyrazolo[3,4-b]pyridine;N-propylformamide |
| SMILES | CCCNC=O.CCn1ncc2c(Cl)ccnc21 |
| InChI | InChI=1S/C8H8ClN3.C4H9NO/c1-2-12-8-6(5-11-12)7(9)3-4-10-8;1-2-3-5-4-6/h3-5H,2H2,1H3;4H,2-3H2,1H3,(H,5,6) |
| InChIKey | JDHOOXZXDVQMRH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1-ethylpyrazolo[3,4-b]pyridine;N-propylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-ethylpyrazolo[3,4-b]pyridine;N-propylformamide?
The IUPAC name of 4-chloro-1-ethylpyrazolo[3,4-b]pyridine;N-propylformamide (CID 87653399) is 4-chloro-1-ethylpyrazolo[3,4-b]pyridine;N-propylformamide.
What is the SMILES notation for 4-chloro-1-ethylpyrazolo[3,4-b]pyridine;N-propylformamide?
The canonical SMILES for 4-chloro-1-ethylpyrazolo[3,4-b]pyridine;N-propylformamide is CCCNC=O.CCn1ncc2c(Cl)ccnc21.
What is the InChIKey of 4-chloro-1-ethylpyrazolo[3,4-b]pyridine;N-propylformamide?
The InChIKey is JDHOOXZXDVQMRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN3.C4H9NO/c1-2-12-8-6(5-11-12)7(9)3-4-10-8;1-2-3-5-4-6/h3-5H,2H2,1H3;4H,2-3H2,1H3,(H,5,6).
What are the key properties of 4-chloro-1-ethylpyrazolo[3,4-b]pyridine;N-propylformamide?
4-chloro-1-ethylpyrazolo[3,4-b]pyridine;N-propylformamide has a molecular weight of 268.75 g/mol, XLogP of 2.25, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-ethylpyrazolo[3,4-b]pyridine;N-propylformamide is sourced from PubChem (CID 87653399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).