About 4-ethenoxy-1-methoxy-1,4-dioxobutane-2-sulfonic acid
4-ethenoxy-1-methoxy-1,4-dioxobutane-2-sulfonic acid (PubChem CID 87653722) has the molecular formula C7H10O7S
and a molecular weight of 238.22 g/mol. Its IUPAC name is 4-ethenoxy-1-methoxy-1,4-dioxobutane-2-sulfonic acid.
Molecular Properties
| Compound Name | 4-ethenoxy-1-methoxy-1,4-dioxobutane-2-sulfonic acid |
| PubChem CID | 87653722 |
| Molecular Formula | C7H10O7S |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 4-ethenoxy-1-methoxy-1,4-dioxobutane-2-sulfonic acid |
| SMILES | C=COC(=O)CC(C(=O)OC)S(=O)(=O)O |
| InChI | InChI=1S/C7H10O7S/c1-3-14-6(8)4-5(7(9)13-2)15(10,11)12/h3,5H,1,4H2,2H3,(H,10,11,12) |
| InChIKey | RXEPOBMUVTWXIK-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenoxy-1-methoxy-1,4-dioxobutane-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenoxy-1-methoxy-1,4-dioxobutane-2-sulfonic acid?
The IUPAC name of 4-ethenoxy-1-methoxy-1,4-dioxobutane-2-sulfonic acid (CID 87653722) is 4-ethenoxy-1-methoxy-1,4-dioxobutane-2-sulfonic acid.
What is the SMILES notation for 4-ethenoxy-1-methoxy-1,4-dioxobutane-2-sulfonic acid?
The canonical SMILES for 4-ethenoxy-1-methoxy-1,4-dioxobutane-2-sulfonic acid is C=COC(=O)CC(C(=O)OC)S(=O)(=O)O.
What is the InChIKey of 4-ethenoxy-1-methoxy-1,4-dioxobutane-2-sulfonic acid?
The InChIKey is RXEPOBMUVTWXIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O7S/c1-3-14-6(8)4-5(7(9)13-2)15(10,11)12/h3,5H,1,4H2,2H3,(H,10,11,12).
What are the key properties of 4-ethenoxy-1-methoxy-1,4-dioxobutane-2-sulfonic acid?
4-ethenoxy-1-methoxy-1,4-dioxobutane-2-sulfonic acid has a molecular weight of 238.22 g/mol, XLogP of -0.51, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenoxy-1-methoxy-1,4-dioxobutane-2-sulfonic acid is sourced from PubChem (CID 87653722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).