1,1-dimethyl-2-propylimidazol-1-ium tetrafluoroborate

C8H15BF4N2 — CID 87653768

IUPAC1,1-dimethyl-2-propylimidazol-1-ium tetrafluoroborate
SMILESCCCC1=NC=C[N+]1(C)C.F[B-](F)(F)F
InChIInChI=1S/C8H15N2.BF4/c1-4-5-8-9-6-7-10(8,2)3;2-1(3,4)5/h6-7H,4-5H2,1-3H3;/q+1;-1
InChIKeyLPSFBWLRTZKWHF-UHFFFAOYSA-N
MW226.03 g/mol
LogP3.05
Rot. Bonds2

About 1,1-dimethyl-2-propylimidazol-1-ium tetrafluoroborate

1,1-dimethyl-2-propylimidazol-1-ium tetrafluoroborate (PubChem CID 87653768) has the molecular formula C8H15BF4N2 and a molecular weight of 226.03 g/mol. Its IUPAC name is 1,1-dimethyl-2-propylimidazol-1-ium tetrafluoroborate.

Molecular Properties

Compound Name1,1-dimethyl-2-propylimidazol-1-ium tetrafluoroborate
PubChem CID87653768
Molecular FormulaC8H15BF4N2
Molecular Weight226.03 g/mol
Exact Mass226.13
IUPAC Name1,1-dimethyl-2-propylimidazol-1-ium tetrafluoroborate
SMILESCCCC1=NC=C[N+]1(C)C.F[B-](F)(F)F
InChIInChI=1S/C8H15N2.BF4/c1-4-5-8-9-6-7-10(8,2)3;2-1(3,4)5/h6-7H,4-5H2,1-3H3;/q+1;-1
InChIKeyLPSFBWLRTZKWHF-UHFFFAOYSA-N
XLogP3.05
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.03
LogP ≤ 53.05
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze 1,1-dimethyl-2-propylimidazol-1-ium tetrafluoroborate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1-dimethyl-2-propylimidazol-1-ium tetrafluoroborate?
The IUPAC name of 1,1-dimethyl-2-propylimidazol-1-ium tetrafluoroborate (CID 87653768) is 1,1-dimethyl-2-propylimidazol-1-ium tetrafluoroborate.
What is the SMILES notation for 1,1-dimethyl-2-propylimidazol-1-ium tetrafluoroborate?
The canonical SMILES for 1,1-dimethyl-2-propylimidazol-1-ium tetrafluoroborate is CCCC1=NC=C[N+]1(C)C.F[B-](F)(F)F.
What is the InChIKey of 1,1-dimethyl-2-propylimidazol-1-ium tetrafluoroborate?
The InChIKey is LPSFBWLRTZKWHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N2.BF4/c1-4-5-8-9-6-7-10(8,2)3;2-1(3,4)5/h6-7H,4-5H2,1-3H3;/q+1;-1.
What are the key properties of 1,1-dimethyl-2-propylimidazol-1-ium tetrafluoroborate?
1,1-dimethyl-2-propylimidazol-1-ium tetrafluoroborate has a molecular weight of 226.03 g/mol, XLogP of 3.05, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-2-propylimidazol-1-ium tetrafluoroborate is sourced from PubChem (CID 87653768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).