About (dibutylamino)-tris[ethyl(methyl)amino]phosphanium;trifluoroborane
(dibutylamino)-tris[ethyl(methyl)amino]phosphanium;trifluoroborane (PubChem CID 87654047) has the molecular formula C17H42BF3N4P+
and a molecular weight of 401.33 g/mol. Its IUPAC name is (dibutylamino)-tris[ethyl(methyl)amino]phosphanium;trifluoroborane.
Molecular Properties
| Compound Name | (dibutylamino)-tris[ethyl(methyl)amino]phosphanium;trifluoroborane |
| PubChem CID | 87654047 |
| Molecular Formula | C17H42BF3N4P+ |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 401.32 |
| IUPAC Name | (dibutylamino)-tris[ethyl(methyl)amino]phosphanium;trifluoroborane |
| SMILES | CCCCN(CCCC)[P+](N(C)CC)(N(C)CC)N(C)CC.FB(F)F |
| InChI | InChI=1S/C17H42N4P.BF3/c1-9-14-16-21(17-15-10-2)22(18(6)11-3,19(7)12-4)20(8)13-5;2-1(3)4/h9-17H2,1-8H3;/q+1; |
| InChIKey | BTCJGWMFGJMUKT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (dibutylamino)-tris[ethyl(methyl)amino]phosphanium;trifluoroborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (dibutylamino)-tris[ethyl(methyl)amino]phosphanium;trifluoroborane?
The IUPAC name of (dibutylamino)-tris[ethyl(methyl)amino]phosphanium;trifluoroborane (CID 87654047) is (dibutylamino)-tris[ethyl(methyl)amino]phosphanium;trifluoroborane.
What is the SMILES notation for (dibutylamino)-tris[ethyl(methyl)amino]phosphanium;trifluoroborane?
The canonical SMILES for (dibutylamino)-tris[ethyl(methyl)amino]phosphanium;trifluoroborane is CCCCN(CCCC)[P+](N(C)CC)(N(C)CC)N(C)CC.FB(F)F.
What is the InChIKey of (dibutylamino)-tris[ethyl(methyl)amino]phosphanium;trifluoroborane?
The InChIKey is BTCJGWMFGJMUKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H42N4P.BF3/c1-9-14-16-21(17-15-10-2)22(18(6)11-3,19(7)12-4)20(8)13-5;2-1(3)4/h9-17H2,1-8H3;/q+1;.
What are the key properties of (dibutylamino)-tris[ethyl(methyl)amino]phosphanium;trifluoroborane?
(dibutylamino)-tris[ethyl(methyl)amino]phosphanium;trifluoroborane has a molecular weight of 401.33 g/mol, XLogP of 5.30, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (dibutylamino)-tris[ethyl(methyl)amino]phosphanium;trifluoroborane is sourced from PubChem (CID 87654047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).