C27H34N4O5S — CID 87654446
4-methoxy-N,2,3,6-tetramethyl-N-[2-[2-oxo-2-(4-phenyl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)ethoxy]ethyl]benzenesulfonamide (PubChem CID 87654446) has the molecular formula C27H34N4O5S and a molecular weight of 526.66 g/mol. Its IUPAC name is 4-methoxy-N,2,3,6-tetramethyl-N-[2-[2-oxo-2-(4-phenyl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)ethoxy]ethyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N,2,3,6-tetramethyl-N-[2-[2-oxo-2-(4-phenyl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)ethoxy]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 87654446 |
| Molecular Formula | C27H34N4O5S |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 4-methoxy-N,2,3,6-tetramethyl-N-[2-[2-oxo-2-(4-phenyl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)ethoxy]ethyl]benzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N(C)CCOCC(=O)N2CCc3[nH]cnc3C2c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C27H34N4O5S/c1-18-15-23(35-5)19(2)20(3)27(18)37(33,34)30(4)13-14-36-16-24(32)31-12-11-22-25(29-17-28-22)26(31)21-9-7-6-8-10-21/h6-10,15,17,26H,11-14,16H2,1-5H3,(H,28,29) |
| InChIKey | GAYUBVYNJYJXSD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|