C16H13Cl2N7O3S — CID 87654467
1-[3-(2,5-dichloro-4-nitroanilino)pyrido[2,3-b]pyrazin-6-yl]-3-ethyl-1-sulfanylurea (PubChem CID 87654467) has the molecular formula C16H13Cl2N7O3S and a molecular weight of 454.30 g/mol. Its IUPAC name is 1-[3-(2,5-dichloro-4-nitroanilino)pyrido[2,3-b]pyrazin-6-yl]-3-ethyl-1-sulfanylurea.
| Compound Name | 1-[3-(2,5-dichloro-4-nitroanilino)pyrido[2,3-b]pyrazin-6-yl]-3-ethyl-1-sulfanylurea |
|---|---|
| PubChem CID | 87654467 |
| Molecular Formula | C16H13Cl2N7O3S |
| Molecular Weight | 454.30 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | 1-[3-(2,5-dichloro-4-nitroanilino)pyrido[2,3-b]pyrazin-6-yl]-3-ethyl-1-sulfanylurea |
| SMILES | CCNC(=O)N(S)c1ccc2ncc(Nc3cc(Cl)c([N+](=O)[O-])cc3Cl)nc2n1 |
| InChI | InChI=1S/C16H13Cl2N7O3S/c1-2-19-16(26)24(29)14-4-3-10-15(23-14)22-13(7-20-10)21-11-5-9(18)12(25(27)28)6-8(11)17/h3-7,29H,2H2,1H3,(H,19,26)(H,21,22,23) |
| InChIKey | STEZPNCRKVCOND-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.30 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|