C27H35N5O8S — CID 87654481
[4-[1,3-benzodioxol-5-ylsulfonyl(2-methylpropyl)amino]-1-[4-[3-(triazol-2-yl)propoxy]phenyl]butan-2-yl]-hydroxycarbamic acid (PubChem CID 87654481) has the molecular formula C27H35N5O8S and a molecular weight of 589.67 g/mol. Its IUPAC name is [4-[1,3-benzodioxol-5-ylsulfonyl(2-methylpropyl)amino]-1-[4-[3-(triazol-2-yl)propoxy]phenyl]butan-2-yl]-hydroxycarbamic acid.
| Compound Name | [4-[1,3-benzodioxol-5-ylsulfonyl(2-methylpropyl)amino]-1-[4-[3-(triazol-2-yl)propoxy]phenyl]butan-2-yl]-hydroxycarbamic acid |
|---|---|
| PubChem CID | 87654481 |
| Molecular Formula | C27H35N5O8S |
| Molecular Weight | 589.67 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | [4-[1,3-benzodioxol-5-ylsulfonyl(2-methylpropyl)amino]-1-[4-[3-(triazol-2-yl)propoxy]phenyl]butan-2-yl]-hydroxycarbamic acid |
| SMILES | CC(C)CN(CCC(Cc1ccc(OCCCn2nccn2)cc1)N(O)C(=O)O)S(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H35N5O8S/c1-20(2)18-30(41(36,37)24-8-9-25-26(17-24)40-19-39-25)14-10-22(32(35)27(33)34)16-21-4-6-23(7-5-21)38-15-3-13-31-28-11-12-29-31/h4-9,11-12,17,20,22,35H,3,10,13-16,18-19H2,1-2H3,(H,33,34) |
| InChIKey | CYMLZPCKLSETQX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.67 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|