About 2-bromo-N-carbamoyl-2-ethylbutanamide;oct-1-ene
2-bromo-N-carbamoyl-2-ethylbutanamide;oct-1-ene (PubChem CID 87655270) has the molecular formula C15H29BrN2O2
and a molecular weight of 349.31 g/mol. Its IUPAC name is 2-bromo-N-carbamoyl-2-ethylbutanamide;oct-1-ene.
Molecular Properties
| Compound Name | 2-bromo-N-carbamoyl-2-ethylbutanamide;oct-1-ene |
| PubChem CID | 87655270 |
| Molecular Formula | C15H29BrN2O2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-bromo-N-carbamoyl-2-ethylbutanamide;oct-1-ene |
| SMILES | C=CCCCCCC.CCC(Br)(CC)C(=O)NC(N)=O |
| InChI | InChI=1S/C8H16.C7H13BrN2O2/c1-3-5-7-8-6-4-2;1-3-7(8,4-2)5(11)10-6(9)12/h3H,1,4-8H2,2H3;3-4H2,1-2H3,(H3,9,10,11,12) |
| InChIKey | JVLZUEAXXGKYTA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-carbamoyl-2-ethylbutanamide;oct-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-carbamoyl-2-ethylbutanamide;oct-1-ene?
The IUPAC name of 2-bromo-N-carbamoyl-2-ethylbutanamide;oct-1-ene (CID 87655270) is 2-bromo-N-carbamoyl-2-ethylbutanamide;oct-1-ene.
What is the SMILES notation for 2-bromo-N-carbamoyl-2-ethylbutanamide;oct-1-ene?
The canonical SMILES for 2-bromo-N-carbamoyl-2-ethylbutanamide;oct-1-ene is C=CCCCCCC.CCC(Br)(CC)C(=O)NC(N)=O.
What is the InChIKey of 2-bromo-N-carbamoyl-2-ethylbutanamide;oct-1-ene?
The InChIKey is JVLZUEAXXGKYTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16.C7H13BrN2O2/c1-3-5-7-8-6-4-2;1-3-7(8,4-2)5(11)10-6(9)12/h3H,1,4-8H2,2H3;3-4H2,1-2H3,(H3,9,10,11,12).
What are the key properties of 2-bromo-N-carbamoyl-2-ethylbutanamide;oct-1-ene?
2-bromo-N-carbamoyl-2-ethylbutanamide;oct-1-ene has a molecular weight of 349.31 g/mol, XLogP of 4.28, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-carbamoyl-2-ethylbutanamide;oct-1-ene is sourced from PubChem (CID 87655270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).