C18H25NO5 — CID 87655300
tert-butyl (4S)-4-[(3-formylphenoxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 87655300) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(3-formylphenoxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(3-formylphenoxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 87655300 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | tert-butyl (4S)-4-[(3-formylphenoxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](COc2cccc(C=O)c2)COC1(C)C |
| InChI | InChI=1S/C18H25NO5/c1-17(2,3)24-16(21)19-14(12-23-18(19,4)5)11-22-15-8-6-7-13(9-15)10-20/h6-10,14H,11-12H2,1-5H3/t14-/m0/s1 |
| InChIKey | HMEKNYSWSLIFDF-AWEZNQCLSA-N |
| XLogP | 3.25 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|