C19H46N4O2P+ — CID 87655552
tris[butyl(methyl)amino]-(1,1-dimethoxyethylamino)phosphanium (PubChem CID 87655552) has the molecular formula C19H46N4O2P+ and a molecular weight of 393.58 g/mol. Its IUPAC name is tris[butyl(methyl)amino]-(1,1-dimethoxyethylamino)phosphanium.
| Compound Name | tris[butyl(methyl)amino]-(1,1-dimethoxyethylamino)phosphanium |
|---|---|
| PubChem CID | 87655552 |
| Molecular Formula | C19H46N4O2P+ |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.34 |
| IUPAC Name | tris[butyl(methyl)amino]-(1,1-dimethoxyethylamino)phosphanium |
| SMILES | CCCCN(C)[P+](NC(C)(OC)OC)(N(C)CCCC)N(C)CCCC |
| InChI | InChI=1S/C19H46N4O2P/c1-10-13-16-21(5)26(22(6)17-14-11-2,23(7)18-15-12-3)20-19(4,24-8)25-9/h20H,10-18H2,1-9H3/q+1 |
| InChIKey | IYISNMNXMDGEKJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 40.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|