C18H16N2O4S2 — CID 8765617
(2,6-dimethylphenyl) 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate (PubChem CID 8765617) has the molecular formula C18H16N2O4S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate.
| Compound Name | (2,6-dimethylphenyl) 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
|---|---|
| PubChem CID | 8765617 |
| Molecular Formula | C18H16N2O4S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | (2,6-dimethylphenyl) 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
| SMILES | Cc1cccc(C)c1OC(=O)c1ccc2c(c1)SC1=NS(=O)(=O)CCN12 |
| InChI | InChI=1S/C18H16N2O4S2/c1-11-4-3-5-12(2)16(11)24-17(21)13-6-7-14-15(10-13)25-18-19-26(22,23)9-8-20(14)18/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | ZFJUFXMKGURFPB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|