About dimethyl (2Z)-2-(1,2-dimethoxyethylidene)-3-oxopentanedioate
dimethyl (2Z)-2-(1,2-dimethoxyethylidene)-3-oxopentanedioate (PubChem CID 87656811) has the molecular formula C11H16O7
and a molecular weight of 260.24 g/mol. Its IUPAC name is dimethyl (2Z)-2-(1,2-dimethoxyethylidene)-3-oxopentanedioate.
Molecular Properties
| Compound Name | dimethyl (2Z)-2-(1,2-dimethoxyethylidene)-3-oxopentanedioate |
| PubChem CID | 87656811 |
| Molecular Formula | C11H16O7 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | dimethyl (2Z)-2-(1,2-dimethoxyethylidene)-3-oxopentanedioate |
| SMILES | COC/C(OC)=C(\C(=O)CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C11H16O7/c1-15-6-8(16-2)10(11(14)18-4)7(12)5-9(13)17-3/h5-6H2,1-4H3/b10-8- |
| InChIKey | HCRRKMUFDVYCHD-NTMALXAHSA-N |
| XLogP | -0.16 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (2Z)-2-(1,2-dimethoxyethylidene)-3-oxopentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (2Z)-2-(1,2-dimethoxyethylidene)-3-oxopentanedioate?
The IUPAC name of dimethyl (2Z)-2-(1,2-dimethoxyethylidene)-3-oxopentanedioate (CID 87656811) is dimethyl (2Z)-2-(1,2-dimethoxyethylidene)-3-oxopentanedioate.
What is the SMILES notation for dimethyl (2Z)-2-(1,2-dimethoxyethylidene)-3-oxopentanedioate?
The canonical SMILES for dimethyl (2Z)-2-(1,2-dimethoxyethylidene)-3-oxopentanedioate is COC/C(OC)=C(\C(=O)CC(=O)OC)C(=O)OC.
What is the InChIKey of dimethyl (2Z)-2-(1,2-dimethoxyethylidene)-3-oxopentanedioate?
The InChIKey is HCRRKMUFDVYCHD-NTMALXAHSA-N. The full InChI is InChI=1S/C11H16O7/c1-15-6-8(16-2)10(11(14)18-4)7(12)5-9(13)17-3/h5-6H2,1-4H3/b10-8-.
What are the key properties of dimethyl (2Z)-2-(1,2-dimethoxyethylidene)-3-oxopentanedioate?
dimethyl (2Z)-2-(1,2-dimethoxyethylidene)-3-oxopentanedioate has a molecular weight of 260.24 g/mol, XLogP of -0.16, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (2Z)-2-(1,2-dimethoxyethylidene)-3-oxopentanedioate is sourced from PubChem (CID 87656811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).