C11H8F10 — CID 87656886
1,2,3,4,5,6,7-heptafluoro-5-propan-2-yl-6-(trifluoromethyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 87656886) has the molecular formula C11H8F10 and a molecular weight of 330.17 g/mol. Its IUPAC name is 1,2,3,4,5,6,7-heptafluoro-5-propan-2-yl-6-(trifluoromethyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 1,2,3,4,5,6,7-heptafluoro-5-propan-2-yl-6-(trifluoromethyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 87656886 |
| Molecular Formula | C11H8F10 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 1,2,3,4,5,6,7-heptafluoro-5-propan-2-yl-6-(trifluoromethyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | CC(C)C1(F)C2(F)C(F)=C(F)C(F)(C2F)C1(F)C(F)(F)F |
| InChI | InChI=1S/C11H8F10/c1-3(2)9(17)7(15)4(12)5(13)8(16,6(7)14)10(9,18)11(19,20)21/h3,6H,1-2H3 |
| InChIKey | GDDKBBDMXJLHBG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |