About 4-N-cyclohexyl-6-(2,6-dichloro-3-pyridinyl)quinazoline-2,4-diamine
4-N-cyclohexyl-6-(2,6-dichloro-3-pyridinyl)quinazoline-2,4-diamine (PubChem CID 87656967) has the molecular formula C19H19Cl2N5
and a molecular weight of 388.30 g/mol. Its IUPAC name is 4-N-cyclohexyl-6-(2,6-dichloro-3-pyridinyl)quinazoline-2,4-diamine.
Molecular Properties
| Compound Name | 4-N-cyclohexyl-6-(2,6-dichloro-3-pyridinyl)quinazoline-2,4-diamine |
| PubChem CID | 87656967 |
| Molecular Formula | C19H19Cl2N5 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 4-N-cyclohexyl-6-(2,6-dichloro-3-pyridinyl)quinazoline-2,4-diamine |
| SMILES | Nc1nc(NC2CCCCC2)c2cc(-c3ccc(Cl)nc3Cl)ccc2n1 |
| InChI | InChI=1S/C19H19Cl2N5/c20-16-9-7-13(17(21)25-16)11-6-8-15-14(10-11)18(26-19(22)24-15)23-12-4-2-1-3-5-12/h6-10,12H,1-5H2,(H3,22,23,24,26) |
| InChIKey | OBHICRMUOYKOLN-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-N-cyclohexyl-6-(2,6-dichloro-3-pyridinyl)quinazoline-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-cyclohexyl-6-(2,6-dichloro-3-pyridinyl)quinazoline-2,4-diamine?
The IUPAC name of 4-N-cyclohexyl-6-(2,6-dichloro-3-pyridinyl)quinazoline-2,4-diamine (CID 87656967) is 4-N-cyclohexyl-6-(2,6-dichloro-3-pyridinyl)quinazoline-2,4-diamine.
What is the SMILES notation for 4-N-cyclohexyl-6-(2,6-dichloro-3-pyridinyl)quinazoline-2,4-diamine?
The canonical SMILES for 4-N-cyclohexyl-6-(2,6-dichloro-3-pyridinyl)quinazoline-2,4-diamine is Nc1nc(NC2CCCCC2)c2cc(-c3ccc(Cl)nc3Cl)ccc2n1.
What is the InChIKey of 4-N-cyclohexyl-6-(2,6-dichloro-3-pyridinyl)quinazoline-2,4-diamine?
The InChIKey is OBHICRMUOYKOLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19Cl2N5/c20-16-9-7-13(17(21)25-16)11-6-8-15-14(10-11)18(26-19(22)24-15)23-12-4-2-1-3-5-12/h6-10,12H,1-5H2,(H3,22,23,24,26).
What are the key properties of 4-N-cyclohexyl-6-(2,6-dichloro-3-pyridinyl)quinazoline-2,4-diamine?
4-N-cyclohexyl-6-(2,6-dichloro-3-pyridinyl)quinazoline-2,4-diamine has a molecular weight of 388.30 g/mol, XLogP of 5.33, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-cyclohexyl-6-(2,6-dichloro-3-pyridinyl)quinazoline-2,4-diamine is sourced from PubChem (CID 87656967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).