C14H16N2O14S4 — CID 87657066
3-(2,5-dioxopyrrolidin-1-yl)oxy-1-[[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxo-1-sulfopropyl]disulfanyl]-3-oxopropane-1-sulfonic acid (PubChem CID 87657066) has the molecular formula C14H16N2O14S4 and a molecular weight of 564.55 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)oxy-1-[[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxo-1-sulfopropyl]disulfanyl]-3-oxopropane-1-sulfonic acid.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)oxy-1-[[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxo-1-sulfopropyl]disulfanyl]-3-oxopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 87657066 |
| Molecular Formula | C14H16N2O14S4 |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 563.95 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)oxy-1-[[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxo-1-sulfopropyl]disulfanyl]-3-oxopropane-1-sulfonic acid |
| SMILES | O=C(CC(SSC(CC(=O)ON1C(=O)CCC1=O)S(=O)(=O)O)S(=O)(=O)O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H16N2O14S4/c17-7-1-2-8(18)15(7)29-11(21)5-13(33(23,24)25)31-32-14(34(26,27)28)6-12(22)30-16-9(19)3-4-10(16)20/h13-14H,1-6H2,(H,23,24,25)(H,26,27,28) |
| InChIKey | MCTYHYCSJAKOEV-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 236.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|