C37H44F2O8S2 — CID 87657071
2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonic acid;tert-butyl 2-(triphenyl-λ4-sulfanyl)oxyacetate (PubChem CID 87657071) has the molecular formula C37H44F2O8S2 and a molecular weight of 718.88 g/mol. Its IUPAC name is 2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonic acid;tert-butyl 2-(triphenyl-λ4-sulfanyl)oxyacetate.
| Compound Name | 2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonic acid;tert-butyl 2-(triphenyl-λ4-sulfanyl)oxyacetate |
|---|---|
| PubChem CID | 87657071 |
| Molecular Formula | C37H44F2O8S2 |
| Molecular Weight | 718.88 g/mol |
| Exact Mass | 718.24 |
| IUPAC Name | 2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonic acid;tert-butyl 2-(triphenyl-λ4-sulfanyl)oxyacetate |
| SMILES | CC(C)(C)OC(=O)COS(c1ccccc1)(c1ccccc1)c1ccccc1.O=C(OCC(F)(F)S(=O)(=O)O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H26O3S.C13H18F2O5S/c1-24(2,3)27-23(25)19-26-28(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22;14-13(15,21(17,18)19)7-20-11(16)12-4-8-1-9(5-12)3-10(2-8)6-12/h4-18H,19H2,1-3H3;8-10H,1-7H2,(H,17,18,19) |
| InChIKey | UQBITJMXWXXTGB-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.88 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|