C22H21FN2S — CID 87657267
[2-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)-6-fluorophenyl]-naphthalen-1-ylmethanethiol (PubChem CID 87657267) has the molecular formula C22H21FN2S and a molecular weight of 364.49 g/mol. Its IUPAC name is [2-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)-6-fluorophenyl]-naphthalen-1-ylmethanethiol.
| Compound Name | [2-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)-6-fluorophenyl]-naphthalen-1-ylmethanethiol |
|---|---|
| PubChem CID | 87657267 |
| Molecular Formula | C22H21FN2S |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | [2-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)-6-fluorophenyl]-naphthalen-1-ylmethanethiol |
| SMILES | CC1(C)CN=C(c2cccc(F)c2C(S)c2cccc3ccccc23)N1 |
| InChI | InChI=1S/C22H21FN2S/c1-22(2)13-24-21(25-22)17-11-6-12-18(23)19(17)20(26)16-10-5-8-14-7-3-4-9-15(14)16/h3-12,20,26H,13H2,1-2H3,(H,24,25) |
| InChIKey | QNNLNRFDZOUAJL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|