C24H24N6O10S2 — CID 87657410
3,9-bis[(2-nitrophenyl)sulfonyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-triene-6-carboxylic acid (PubChem CID 87657410) has the molecular formula C24H24N6O10S2 and a molecular weight of 620.62 g/mol. Its IUPAC name is 3,9-bis[(2-nitrophenyl)sulfonyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-triene-6-carboxylic acid.
| Compound Name | 3,9-bis[(2-nitrophenyl)sulfonyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-triene-6-carboxylic acid |
|---|---|
| PubChem CID | 87657410 |
| Molecular Formula | C24H24N6O10S2 |
| Molecular Weight | 620.62 g/mol |
| Exact Mass | 620.10 |
| IUPAC Name | 3,9-bis[(2-nitrophenyl)sulfonyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-triene-6-carboxylic acid |
| SMILES | O=C(O)N1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])Cc2cccc(n2)CN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C24H24N6O10S2/c31-24(32)26-12-14-27(41(37,38)22-10-3-1-8-20(22)29(33)34)16-18-6-5-7-19(25-18)17-28(15-13-26)42(39,40)23-11-4-2-9-21(23)30(35)36/h1-11H,12-17H2,(H,31,32) |
| InChIKey | LICLDMXQZXVOFP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 214.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.62 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|