About sodium;formaldehyde;2-hydroxybenzenesulfonate
sodium;formaldehyde;2-hydroxybenzenesulfonate (PubChem CID 87657944) has the molecular formula C7H7NaO5S
and a molecular weight of 226.18 g/mol. Its IUPAC name is sodium;formaldehyde;2-hydroxybenzenesulfonate.
Molecular Properties
| Compound Name | sodium;formaldehyde;2-hydroxybenzenesulfonate |
| PubChem CID | 87657944 |
| Molecular Formula | C7H7NaO5S |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | sodium;formaldehyde;2-hydroxybenzenesulfonate |
| SMILES | C=O.O=S(=O)([O-])c1ccccc1O.[Na+] |
| InChI | InChI=1S/C6H6O4S.CH2O.Na/c7-5-3-1-2-4-6(5)11(8,9)10;1-2;/h1-4,7H,(H,8,9,10);1H2;/q;;+1/p-1 |
| InChIKey | IDHPJXIDLJGOBU-UHFFFAOYSA-M |
| XLogP | -2.88 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;formaldehyde;2-hydroxybenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;formaldehyde;2-hydroxybenzenesulfonate?
The IUPAC name of sodium;formaldehyde;2-hydroxybenzenesulfonate (CID 87657944) is sodium;formaldehyde;2-hydroxybenzenesulfonate.
What is the SMILES notation for sodium;formaldehyde;2-hydroxybenzenesulfonate?
The canonical SMILES for sodium;formaldehyde;2-hydroxybenzenesulfonate is C=O.O=S(=O)([O-])c1ccccc1O.[Na+].
What is the InChIKey of sodium;formaldehyde;2-hydroxybenzenesulfonate?
The InChIKey is IDHPJXIDLJGOBU-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6O4S.CH2O.Na/c7-5-3-1-2-4-6(5)11(8,9)10;1-2;/h1-4,7H,(H,8,9,10);1H2;/q;;+1/p-1.
What are the key properties of sodium;formaldehyde;2-hydroxybenzenesulfonate?
sodium;formaldehyde;2-hydroxybenzenesulfonate has a molecular weight of 226.18 g/mol, XLogP of -2.88, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;formaldehyde;2-hydroxybenzenesulfonate is sourced from PubChem (CID 87657944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).