About 1-[[4-(5-hydroxy-2-methylanilino)quinolin-8-yl]-methyl-nitroso-λ4-sulfanyl]ethanone
1-[[4-(5-hydroxy-2-methylanilino)quinolin-8-yl]-methyl-nitroso-λ4-sulfanyl]ethanone (PubChem CID 87658008) has the molecular formula C19H19N3O3S
and a molecular weight of 369.45 g/mol. Its IUPAC name is 1-[[4-(5-hydroxy-2-methylanilino)quinolin-8-yl]-methyl-nitroso-λ4-sulfanyl]ethanone.
Molecular Properties
| Compound Name | 1-[[4-(5-hydroxy-2-methylanilino)quinolin-8-yl]-methyl-nitroso-λ4-sulfanyl]ethanone |
| PubChem CID | 87658008 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 1-[[4-(5-hydroxy-2-methylanilino)quinolin-8-yl]-methyl-nitroso-λ4-sulfanyl]ethanone |
| SMILES | CC(=O)S(C)(N=O)c1cccc2c(Nc3cc(O)ccc3C)ccnc12 |
| InChI | InChI=1S/C19H19N3O3S/c1-12-7-8-14(24)11-17(12)21-16-9-10-20-19-15(16)5-4-6-18(19)26(3,22-25)13(2)23/h4-11,24H,1-3H3,(H,20,21) |
| InChIKey | QDXJAQRVPRONTI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 1-[[4-(5-hydroxy-2-methylanilino)quinolin-8-yl]-methyl-nitroso-λ4-sulfanyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(5-hydroxy-2-methylanilino)quinolin-8-yl]-methyl-nitroso-λ4-sulfanyl]ethanone?
The IUPAC name of 1-[[4-(5-hydroxy-2-methylanilino)quinolin-8-yl]-methyl-nitroso-λ4-sulfanyl]ethanone (CID 87658008) is 1-[[4-(5-hydroxy-2-methylanilino)quinolin-8-yl]-methyl-nitroso-λ4-sulfanyl]ethanone.
What is the SMILES notation for 1-[[4-(5-hydroxy-2-methylanilino)quinolin-8-yl]-methyl-nitroso-λ4-sulfanyl]ethanone?
The canonical SMILES for 1-[[4-(5-hydroxy-2-methylanilino)quinolin-8-yl]-methyl-nitroso-λ4-sulfanyl]ethanone is CC(=O)S(C)(N=O)c1cccc2c(Nc3cc(O)ccc3C)ccnc12.
What is the InChIKey of 1-[[4-(5-hydroxy-2-methylanilino)quinolin-8-yl]-methyl-nitroso-λ4-sulfanyl]ethanone?
The InChIKey is QDXJAQRVPRONTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O3S/c1-12-7-8-14(24)11-17(12)21-16-9-10-20-19-15(16)5-4-6-18(19)26(3,22-25)13(2)23/h4-11,24H,1-3H3,(H,20,21).
What are the key properties of 1-[[4-(5-hydroxy-2-methylanilino)quinolin-8-yl]-methyl-nitroso-λ4-sulfanyl]ethanone?
1-[[4-(5-hydroxy-2-methylanilino)quinolin-8-yl]-methyl-nitroso-λ4-sulfanyl]ethanone has a molecular weight of 369.45 g/mol, XLogP of 5.01, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(5-hydroxy-2-methylanilino)quinolin-8-yl]-methyl-nitroso-λ4-sulfanyl]ethanone is sourced from PubChem (CID 87658008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).