C24H44O2 — CID 87658423
dec-5-yne;2,4,7,9-tetramethyldec-5-yne-4,7-diol (PubChem CID 87658423) has the molecular formula C24H44O2 and a molecular weight of 364.61 g/mol. Its IUPAC name is dec-5-yne;2,4,7,9-tetramethyldec-5-yne-4,7-diol.
| Compound Name | dec-5-yne;2,4,7,9-tetramethyldec-5-yne-4,7-diol |
|---|---|
| PubChem CID | 87658423 |
| Molecular Formula | C24H44O2 |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 364.33 |
| IUPAC Name | dec-5-yne;2,4,7,9-tetramethyldec-5-yne-4,7-diol |
| SMILES | CC(C)CC(C)(O)C#CC(C)(O)CC(C)C.CCCCC#CCCCC |
| InChI | InChI=1S/C14H26O2.C10H18/c1-11(2)9-13(5,15)7-8-14(6,16)10-12(3)4;1-3-5-7-9-10-8-6-4-2/h11-12,15-16H,9-10H2,1-6H3;3-8H2,1-2H3 |
| InChIKey | PAAWOICCDZHOCO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|