C9H7N3O2 — CID 87658732
4-nitro-8,11-diazatricyclo[6.3.0.02,5]undeca-1(11),2(5),6,9-tetraene (PubChem CID 87658732) has the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. Its IUPAC name is 4-nitro-8,11-diazatricyclo[6.3.0.02,5]undeca-1(11),2(5),6,9-tetraene.
| Compound Name | 4-nitro-8,11-diazatricyclo[6.3.0.02,5]undeca-1(11),2(5),6,9-tetraene |
|---|---|
| PubChem CID | 87658732 |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 4-nitro-8,11-diazatricyclo[6.3.0.02,5]undeca-1(11),2(5),6,9-tetraene |
| SMILES | O=[N+]([O-])C1Cc2c1ccn1ccnc21 |
| InChI | InChI=1S/C9H7N3O2/c13-12(14)8-5-7-6(8)1-3-11-4-2-10-9(7)11/h1-4,8H,5H2 |
| InChIKey | MYCKAUQPXPVKTJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|