sodium (Z)-2-methylbut-2-enoate

C5H7NaO2 — CID 87659359

IUPACsodium (Z)-2-methylbut-2-enoate
SMILESC/C=C(/C)C(=O)[O-].[Na+]
InChIInChI=1S/C5H8O2.Na/c1-3-4(2)5(6)7;/h3H,1-2H3,(H,6,7);/q;+1/p-1/b4-3-;
InChIKeyORZOYFNBDPVJRG-LNKPDPKZSA-M
MW122.10 g/mol
LogP-3.29
Rot. Bonds1

About sodium (Z)-2-methylbut-2-enoate

sodium (Z)-2-methylbut-2-enoate (PubChem CID 87659359) has the molecular formula C5H7NaO2 and a molecular weight of 122.10 g/mol. Its IUPAC name is sodium (Z)-2-methylbut-2-enoate.

Molecular Properties

Compound Namesodium (Z)-2-methylbut-2-enoate
PubChem CID87659359
Molecular FormulaC5H7NaO2
Molecular Weight122.10 g/mol
Exact Mass122.03
IUPAC Namesodium (Z)-2-methylbut-2-enoate
SMILESC/C=C(/C)C(=O)[O-].[Na+]
InChIInChI=1S/C5H8O2.Na/c1-3-4(2)5(6)7;/h3H,1-2H3,(H,6,7);/q;+1/p-1/b4-3-;
InChIKeyORZOYFNBDPVJRG-LNKPDPKZSA-M
XLogP-3.29
TPSA40.13 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500122.10
LogP ≤ 5-3.29
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze sodium (Z)-2-methylbut-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium (Z)-2-methylbut-2-enoate?
The IUPAC name of sodium (Z)-2-methylbut-2-enoate (CID 87659359) is sodium (Z)-2-methylbut-2-enoate.
What is the SMILES notation for sodium (Z)-2-methylbut-2-enoate?
The canonical SMILES for sodium (Z)-2-methylbut-2-enoate is C/C=C(/C)C(=O)[O-].[Na+].
What is the InChIKey of sodium (Z)-2-methylbut-2-enoate?
The InChIKey is ORZOYFNBDPVJRG-LNKPDPKZSA-M. The full InChI is InChI=1S/C5H8O2.Na/c1-3-4(2)5(6)7;/h3H,1-2H3,(H,6,7);/q;+1/p-1/b4-3-;.
What are the key properties of sodium (Z)-2-methylbut-2-enoate?
sodium (Z)-2-methylbut-2-enoate has a molecular weight of 122.10 g/mol, XLogP of -3.29, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (Z)-2-methylbut-2-enoate is sourced from PubChem (CID 87659359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).