C28H21Br2N2O6+ — CID 87659372
(2,6-dibromophenyl) 10-[1-(2,5-dioxopyrrolidin-3-yl)oxy-1-oxobutan-2-yl]acridin-10-ium-9-carboxylate (PubChem CID 87659372) has the molecular formula C28H21Br2N2O6+ and a molecular weight of 641.29 g/mol. Its IUPAC name is (2,6-dibromophenyl) 10-[1-(2,5-dioxopyrrolidin-3-yl)oxy-1-oxobutan-2-yl]acridin-10-ium-9-carboxylate.
| Compound Name | (2,6-dibromophenyl) 10-[1-(2,5-dioxopyrrolidin-3-yl)oxy-1-oxobutan-2-yl]acridin-10-ium-9-carboxylate |
|---|---|
| PubChem CID | 87659372 |
| Molecular Formula | C28H21Br2N2O6+ |
| Molecular Weight | 641.29 g/mol |
| Exact Mass | 638.98 |
| IUPAC Name | (2,6-dibromophenyl) 10-[1-(2,5-dioxopyrrolidin-3-yl)oxy-1-oxobutan-2-yl]acridin-10-ium-9-carboxylate |
| SMILES | CCC(C(=O)OC1CC(=O)NC1=O)[n+]1c2ccccc2c(C(=O)Oc2c(Br)cccc2Br)c2ccccc21 |
| InChI | InChI=1S/C28H20Br2N2O6/c1-2-19(27(35)37-22-14-23(33)31-26(22)34)32-20-12-5-3-8-15(20)24(16-9-4-6-13-21(16)32)28(36)38-25-17(29)10-7-11-18(25)30/h3-13,19,22H,2,14H2,1H3/p+1 |
| InChIKey | DIMQJUPTPURIOW-UHFFFAOYSA-O |
| XLogP | 4.93 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.29 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|