About 2,4-bis(trifluoromethyl)benzamide;6-phenoxypyridine-3-sulfonic acid
2,4-bis(trifluoromethyl)benzamide;6-phenoxypyridine-3-sulfonic acid (PubChem CID 87659481) has the molecular formula C20H14F6N2O5S
and a molecular weight of 508.40 g/mol. Its IUPAC name is 2,4-bis(trifluoromethyl)benzamide;6-phenoxypyridine-3-sulfonic acid.
Molecular Properties
| Compound Name | 2,4-bis(trifluoromethyl)benzamide;6-phenoxypyridine-3-sulfonic acid |
| PubChem CID | 87659481 |
| Molecular Formula | C20H14F6N2O5S |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | 2,4-bis(trifluoromethyl)benzamide;6-phenoxypyridine-3-sulfonic acid |
| SMILES | NC(=O)c1ccc(C(F)(F)F)cc1C(F)(F)F.O=S(=O)(O)c1ccc(Oc2ccccc2)nc1 |
| InChI | InChI=1S/C11H9NO4S.C9H5F6NO/c13-17(14,15)10-6-7-11(12-8-10)16-9-4-2-1-3-5-9;10-8(11,12)4-1-2-5(7(16)17)6(3-4)9(13,14)15/h1-8H,(H,13,14,15);1-3H,(H2,16,17) |
| InChIKey | AAUKEWJAPJUCHC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-bis(trifluoromethyl)benzamide;6-phenoxypyridine-3-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(trifluoromethyl)benzamide;6-phenoxypyridine-3-sulfonic acid?
The IUPAC name of 2,4-bis(trifluoromethyl)benzamide;6-phenoxypyridine-3-sulfonic acid (CID 87659481) is 2,4-bis(trifluoromethyl)benzamide;6-phenoxypyridine-3-sulfonic acid.
What is the SMILES notation for 2,4-bis(trifluoromethyl)benzamide;6-phenoxypyridine-3-sulfonic acid?
The canonical SMILES for 2,4-bis(trifluoromethyl)benzamide;6-phenoxypyridine-3-sulfonic acid is NC(=O)c1ccc(C(F)(F)F)cc1C(F)(F)F.O=S(=O)(O)c1ccc(Oc2ccccc2)nc1.
What is the InChIKey of 2,4-bis(trifluoromethyl)benzamide;6-phenoxypyridine-3-sulfonic acid?
The InChIKey is AAUKEWJAPJUCHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO4S.C9H5F6NO/c13-17(14,15)10-6-7-11(12-8-10)16-9-4-2-1-3-5-9;10-8(11,12)4-1-2-5(7(16)17)6(3-4)9(13,14)15/h1-8H,(H,13,14,15);1-3H,(H2,16,17).
What are the key properties of 2,4-bis(trifluoromethyl)benzamide;6-phenoxypyridine-3-sulfonic acid?
2,4-bis(trifluoromethyl)benzamide;6-phenoxypyridine-3-sulfonic acid has a molecular weight of 508.40 g/mol, XLogP of 4.94, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(trifluoromethyl)benzamide;6-phenoxypyridine-3-sulfonic acid is sourced from PubChem (CID 87659481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).