C15H21N5O4S3 — CID 87660540
(2S)-6-(hydroxyamino)-2-[[5-(2-methylsulfanylpyrimidin-4-yl)thiophen-2-yl]sulfonylamino]hexanamide (PubChem CID 87660540) has the molecular formula C15H21N5O4S3 and a molecular weight of 431.57 g/mol. Its IUPAC name is (2S)-6-(hydroxyamino)-2-[[5-(2-methylsulfanylpyrimidin-4-yl)thiophen-2-yl]sulfonylamino]hexanamide.
| Compound Name | (2S)-6-(hydroxyamino)-2-[[5-(2-methylsulfanylpyrimidin-4-yl)thiophen-2-yl]sulfonylamino]hexanamide |
|---|---|
| PubChem CID | 87660540 |
| Molecular Formula | C15H21N5O4S3 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | (2S)-6-(hydroxyamino)-2-[[5-(2-methylsulfanylpyrimidin-4-yl)thiophen-2-yl]sulfonylamino]hexanamide |
| SMILES | CSc1nccc(-c2ccc(S(=O)(=O)N[C@@H](CCCCNO)C(N)=O)s2)n1 |
| InChI | InChI=1S/C15H21N5O4S3/c1-25-15-17-9-7-10(19-15)12-5-6-13(26-12)27(23,24)20-11(14(16)21)4-2-3-8-18-22/h5-7,9,11,18,20,22H,2-4,8H2,1H3,(H2,16,21)/t11-/m0/s1 |
| InChIKey | NKTUYISLNWBJJW-NSHDSACASA-N |
| XLogP | 1.21 |
| TPSA | 147.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|