C6H2F14O — CID 87660779
1,1,1,2,3,3,3-heptafluoropropane;1,1,1,2,3,3,3-heptafluoropropan-2-ol (PubChem CID 87660779) has the molecular formula C6H2F14O and a molecular weight of 356.05 g/mol. Its IUPAC name is 1,1,1,2,3,3,3-heptafluoropropane;1,1,1,2,3,3,3-heptafluoropropan-2-ol.
| Compound Name | 1,1,1,2,3,3,3-heptafluoropropane;1,1,1,2,3,3,3-heptafluoropropan-2-ol |
|---|---|
| PubChem CID | 87660779 |
| Molecular Formula | C6H2F14O |
| Molecular Weight | 356.05 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 1,1,1,2,3,3,3-heptafluoropropane;1,1,1,2,3,3,3-heptafluoropropan-2-ol |
| SMILES | FC(C(F)(F)F)C(F)(F)F.OC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C3HF7O.C3HF7/c4-1(11,2(5,6)7)3(8,9)10;4-1(2(5,6)7)3(8,9)10/h11H;1H |
| InChIKey | KMBCPAPNZHJVKV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.05 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |