About 5-bromo-6-chloropyridine-3-sulfonic acid;2-fluoro-4-(trifluoromethyl)benzamide
5-bromo-6-chloropyridine-3-sulfonic acid;2-fluoro-4-(trifluoromethyl)benzamide (PubChem CID 87660991) has the molecular formula C13H8BrClF4N2O4S
and a molecular weight of 479.63 g/mol. Its IUPAC name is 5-bromo-6-chloropyridine-3-sulfonic acid;2-fluoro-4-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | 5-bromo-6-chloropyridine-3-sulfonic acid;2-fluoro-4-(trifluoromethyl)benzamide |
| PubChem CID | 87660991 |
| Molecular Formula | C13H8BrClF4N2O4S |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 477.90 |
| IUPAC Name | 5-bromo-6-chloropyridine-3-sulfonic acid;2-fluoro-4-(trifluoromethyl)benzamide |
| SMILES | NC(=O)c1ccc(C(F)(F)F)cc1F.O=S(=O)(O)c1cnc(Cl)c(Br)c1 |
| InChI | InChI=1S/C8H5F4NO.C5H3BrClNO3S/c9-6-3-4(8(10,11)12)1-2-5(6)7(13)14;6-4-1-3(12(9,10)11)2-8-5(4)7/h1-3H,(H2,13,14);1-2H,(H,9,10,11) |
| InChIKey | WGURRIQOHVJLKD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-6-chloropyridine-3-sulfonic acid;2-fluoro-4-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-chloropyridine-3-sulfonic acid;2-fluoro-4-(trifluoromethyl)benzamide?
The IUPAC name of 5-bromo-6-chloropyridine-3-sulfonic acid;2-fluoro-4-(trifluoromethyl)benzamide (CID 87660991) is 5-bromo-6-chloropyridine-3-sulfonic acid;2-fluoro-4-(trifluoromethyl)benzamide.
What is the SMILES notation for 5-bromo-6-chloropyridine-3-sulfonic acid;2-fluoro-4-(trifluoromethyl)benzamide?
The canonical SMILES for 5-bromo-6-chloropyridine-3-sulfonic acid;2-fluoro-4-(trifluoromethyl)benzamide is NC(=O)c1ccc(C(F)(F)F)cc1F.O=S(=O)(O)c1cnc(Cl)c(Br)c1.
What is the InChIKey of 5-bromo-6-chloropyridine-3-sulfonic acid;2-fluoro-4-(trifluoromethyl)benzamide?
The InChIKey is WGURRIQOHVJLKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F4NO.C5H3BrClNO3S/c9-6-3-4(8(10,11)12)1-2-5(6)7(13)14;6-4-1-3(12(9,10)11)2-8-5(4)7/h1-3H,(H2,13,14);1-2H,(H,9,10,11).
What are the key properties of 5-bromo-6-chloropyridine-3-sulfonic acid;2-fluoro-4-(trifluoromethyl)benzamide?
5-bromo-6-chloropyridine-3-sulfonic acid;2-fluoro-4-(trifluoromethyl)benzamide has a molecular weight of 479.63 g/mol, XLogP of 3.69, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-chloropyridine-3-sulfonic acid;2-fluoro-4-(trifluoromethyl)benzamide is sourced from PubChem (CID 87660991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).