About [3-(7-oxabicyclo[2.2.1]hept-2-en-1-yl)cyclohexyl] propane-2-sulfonate
[3-(7-oxabicyclo[2.2.1]hept-2-en-1-yl)cyclohexyl] propane-2-sulfonate (PubChem CID 87661266) has the molecular formula C15H24O4S
and a molecular weight of 300.42 g/mol. Its IUPAC name is [3-(7-oxabicyclo[2.2.1]hept-2-en-1-yl)cyclohexyl] propane-2-sulfonate.
Molecular Properties
| Compound Name | [3-(7-oxabicyclo[2.2.1]hept-2-en-1-yl)cyclohexyl] propane-2-sulfonate |
| PubChem CID | 87661266 |
| Molecular Formula | C15H24O4S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | [3-(7-oxabicyclo[2.2.1]hept-2-en-1-yl)cyclohexyl] propane-2-sulfonate |
| SMILES | CC(C)S(=O)(=O)OC1CCCC(C23C=CC(CC2)O3)C1 |
| InChI | InChI=1S/C15H24O4S/c1-11(2)20(16,17)19-14-5-3-4-12(10-14)15-8-6-13(18-15)7-9-15/h6,8,11-14H,3-5,7,9-10H2,1-2H3 |
| InChIKey | DPMXZYJWBSEGBW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(7-oxabicyclo[2.2.1]hept-2-en-1-yl)cyclohexyl] propane-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(7-oxabicyclo[2.2.1]hept-2-en-1-yl)cyclohexyl] propane-2-sulfonate?
The IUPAC name of [3-(7-oxabicyclo[2.2.1]hept-2-en-1-yl)cyclohexyl] propane-2-sulfonate (CID 87661266) is [3-(7-oxabicyclo[2.2.1]hept-2-en-1-yl)cyclohexyl] propane-2-sulfonate.
What is the SMILES notation for [3-(7-oxabicyclo[2.2.1]hept-2-en-1-yl)cyclohexyl] propane-2-sulfonate?
The canonical SMILES for [3-(7-oxabicyclo[2.2.1]hept-2-en-1-yl)cyclohexyl] propane-2-sulfonate is CC(C)S(=O)(=O)OC1CCCC(C23C=CC(CC2)O3)C1.
What is the InChIKey of [3-(7-oxabicyclo[2.2.1]hept-2-en-1-yl)cyclohexyl] propane-2-sulfonate?
The InChIKey is DPMXZYJWBSEGBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O4S/c1-11(2)20(16,17)19-14-5-3-4-12(10-14)15-8-6-13(18-15)7-9-15/h6,8,11-14H,3-5,7,9-10H2,1-2H3.
What are the key properties of [3-(7-oxabicyclo[2.2.1]hept-2-en-1-yl)cyclohexyl] propane-2-sulfonate?
[3-(7-oxabicyclo[2.2.1]hept-2-en-1-yl)cyclohexyl] propane-2-sulfonate has a molecular weight of 300.42 g/mol, XLogP of 2.79, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(7-oxabicyclo[2.2.1]hept-2-en-1-yl)cyclohexyl] propane-2-sulfonate is sourced from PubChem (CID 87661266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).